![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/a.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/dvi.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 0213flatcircletext.ps | 2013-02-01 23:04 | 296K | |
| 0213large-equations.ps | 2013-02-01 22:55 | 307K | |
| 0619-ellipse.jpg | 2010-06-28 18:42 | 178K | |
| 0628images.jpg | 2010-06-28 18:42 | 340K | |
| 081030.jpg | 2008-10-30 15:16 | 1.1M | |
| 0825formulas2.aux | 2010-08-25 02:02 | 8 | |
| 0825formulas2.dvi | 2010-08-25 02:02 | 1.1K | |
| 0825formulas2.log | 2010-08-25 02:02 | 8.1K | |
| 0825formulas2.pdf | 2010-08-25 02:02 | 22K | |
| 0825formulas2.ps | 2010-09-01 19:19 | 110K | |
| 0825formulas2.svg | 2010-09-02 15:03 | 126K | |
| 0825formulas2.tex | 2012-03-31 16:25 | 1.1K | |
| 0825formulas3.tex | 2015-02-20 16:05 | 4.2K | |
| 0830formulas1.pdf | 2010-08-30 11:02 | 40K | |
| 0830formulas2.pdf | 2010-08-30 11:02 | 22K | |
| 0830formulas3.pdf | 2010-08-30 11:03 | 30K | |
| 091019to-art-committee | 2009-10-20 17:45 | 1.7K | |
| 0917texfiles1.aux | 2010-09-22 23:55 | 8 | |
| 0917texfiles1.dvi | 2010-09-17 01:43 | 3.2K | |
| 0917texfiles1.log | 2010-09-22 23:55 | 8.2K | |
| 0917texfiles1.pdf | 2010-09-17 01:43 | 41K | |
| 0917texfiles1.tex | 2010-09-23 00:02 | 2.3K | |
| 0917texfiles2.aux | 2010-09-17 01:44 | 8 | |
| 0917texfiles2.dvi | 2010-09-17 01:44 | 14K | |
| 0917texfiles2.log | 2010-09-17 01:44 | 8.5K | |
| 0917texfiles2.pdf | 2010-09-17 01:45 | 31K | |
| 0917texfiles2.tex | 2010-10-13 21:46 | 2.8K | |
| 0917texfiles3.aux | 2010-09-17 01:46 | 8 | |
| 0917texfiles3.dvi | 2010-09-17 01:46 | 1.1K | |
| 0917texfiles3.log | 2010-09-17 01:46 | 8.2K | |
| 0917texfiles3.pdf | 2010-09-17 01:46 | 22K | |
| 0917texfiles3.tex | 2010-09-17 01:42 | 1.1K | |
| 0922texfiles1.aux | 2010-09-23 00:04 | 8 | |
| 0922texfiles1.dvi | 2010-09-23 00:04 | 3.3K | |
| 0922texfiles1.log | 2010-09-23 00:04 | 8.2K | |
| 0922texfiles1.pdf | 2010-09-23 00:04 | 42K | |
| 0922texfiles1.tex | 2010-09-23 00:04 | 2.3K | |
| 3d.zip | 2011-11-23 12:44 | 3.4K | |
| 11.doc | 2010-05-19 14:49 | 200K | |
| 1011texfiles2.aux | 2010-11-15 16:41 | 8 | |
| 1011texfiles2.dvi | 2010-10-11 15:46 | 15K | |
| 1011texfiles2.log | 2010-11-15 16:41 | 8.6K | |
| 1011texfiles2.pdf | 2010-10-11 15:46 | 29K | |
| 1011texfiles2.tex | 2010-10-11 15:46 | 3.1K | |
| 1013texfiles2.aux | 2010-10-13 22:01 | 8 | |
| 1013texfiles2.dvi | 2010-10-13 22:01 | 3.0K | |
| 1013texfiles2.log | 2010-10-13 22:01 | 8.5K | |
| 1013texfiles2.pdf | 2010-10-13 22:01 | 8.0K | |
| 1013texfiles2.tex | 2010-10-13 22:01 | 509 | |
| 1025formulas.aux | 2010-08-25 01:56 | 8 | |
| 1025formulas.dvi | 2010-08-25 01:56 | 3.0K | |
| 1025formulas.log | 2010-08-25 01:56 | 8.2K | |
| 1025formulas.pdf | 2010-08-25 01:56 | 35K | |
| 1025formulas.tex | 2010-08-25 01:45 | 2.3K | |
| 1115texfiles2.aux | 2012-03-29 21:38 | 8 | |
| 1115texfiles2.dvi | 2012-03-29 21:38 | 2.8K | |
| 1115texfiles2.log | 2012-03-29 21:38 | 8.8K | |
| 1115texfiles2.pdf | 2012-03-29 21:39 | 17K | |
| 1115texfiles2.tex | 2010-11-15 17:43 | 914 | |
| 1203/ | 2012-04-06 10:16 | - | |
| 1212formulas/ | 2013-02-07 13:26 | - | |
| 1212gallery_show.pages | 2012-12-03 10:29 | 205K | |
| 30891_Elevation_behindD_StairC.pdf | 2010-09-22 11:02 | 150K | |
| 30891_Elevation_ behind_StairC.pdf | 2010-03-05 18:33 | 150K | |
| 30891_Exhibition Space Plan.pdf | 2009-06-01 21:56 | 41K | |
| 30891_private garden.jpg | 2009-07-03 14:58 | 1.3M | |
| 100628equations.jpg | 2010-06-28 18:41 | 63K | |
| 100630-bad-images.jpg | 2010-08-22 12:17 | 17K | |
| 120514trustees.aux | 2012-05-14 13:16 | 8 | |
| 120514trustees.dvi | 2012-05-14 13:16 | 3.3K | |
| 120514trustees.log | 2012-05-14 13:16 | 3.8K | |
| 120514trustees.pdf | 2012-05-14 13:17 | 21K | |
| 120514trustees.tex | 2012-05-14 13:16 | 2.6K | |
| 121001elyce.html | 2012-10-01 14:07 | 6.1K | |
| 121121-revised-ellipse.gif | 2012-11-21 18:31 | 21K | |
| 121127white1.jpg | 2012-11-27 08:59 | 859K | |
| 121127white2.jpg | 2012-11-27 09:00 | 868K | |
| 121127white3.jpg | 2012-11-27 09:00 | 790K | |
| 130311white1.jpg | 2013-03-11 11:08 | 26K | |
| 130311white2.jpg | 2013-03-11 11:08 | 21K | |
| 130311white3.jpg | 2013-03-11 11:08 | 20K | |
| 130311white4.jpg | 2013-03-11 11:08 | 19K | |
| 130311white5.jpg | 2013-03-11 11:09 | 20K | |
| 130311white6.jpg | 2013-03-11 11:09 | 21K | |
| 130311white7.jpg | 2013-03-11 11:10 | 22K | |
| 130311white8.jpg | 2013-03-11 11:10 | 20K | |
| 130311white9.jpg | 2013-03-11 11:11 | 24K | |
| 130521trustees.aux | 2013-05-21 12:28 | 8 | |
| 130521trustees.dvi | 2013-05-21 12:28 | 5.3K | |
| 130521trustees.log | 2013-05-21 12:28 | 3.8K | |
| 130521trustees.pdf | 2013-05-21 12:28 | 25K | |
| 130521trustees.tex | 2013-05-21 12:28 | 4.1K | |
| 131025trustees.aux | 2013-10-25 12:13 | 8 | |
| 131025trustees.dvi | 2013-10-25 12:13 | 4.0K | |
| 131025trustees.log | 2013-10-25 12:13 | 3.8K | |
| 131025trustees.pdf | 2013-10-25 12:14 | 23K | |
| 131025trustees.tex | 2013-10-25 12:13 | 3.2K | |
| A111.pdf | 2009-06-01 21:55 | 157K | |
| A300.pdf | 2009-06-01 21:56 | 349K | |
| A301.pdf | 2009-06-01 21:56 | 160K | |
| A430.pdf | 2009-06-01 21:56 | 93K | |
| A432.pdf | 2009-06-01 21:56 | 85K | |
| AMajor'13.pdf | 2013-06-26 18:39 | 123K | |
| Agenda_Art_Board_FA_15.pdf | 2015-09-04 11:16 | 56K | |
| Agenda_Art_Board_Meet.pdf | 2014-09-19 09:49 | 49K | |
| Agenda_Art_Board_SP_15.pdf | 2015-05-06 11:29 | 51K | |
| ArtDirector.pdf | 2013-10-15 16:00 | 100K | |
| Art Program and Art for the Center.docx | 2010-06-03 10:47 | 98K | |
| CSWhite-rendering-030812-2.jpg | 2012-03-08 12:52 | 1.7M | |
| CSWhite-rendering-030812.jpg | 2012-03-08 08:39 | 1.5M | |
| CYPI++n-8-7.jpg | 2013-08-20 12:22 | 160K | |
| CarrothersProposal.pdf | 2013-08-28 09:34 | 394K | |
| Center Description.docx | 2008-09-05 14:36 | 12K | |
| ChairSCREENINGFORM.docx | 2012-03-11 11:04 | 12K | |
| DSCN0512.JPG | 2010-03-09 16:51 | 2.1M | |
| DSCN0513.JPG | 2010-03-09 16:52 | 2.1M | |
| DSCN0514.JPG | 2010-03-09 16:55 | 2.2M | |
| DSCN0515.JPG | 2010-03-09 16:56 | 2.1M | |
| DraftPDArtProgramDirector.docx | 2013-10-15 11:53 | 240K | |
| E-5.jpg | 2013-04-11 12:10 | 1.4M | |
| EPSFILES/ | 2010-08-30 10:52 | - | |
| Einstein-eq-fonts.jpg | 2013-03-21 17:45 | 934K | |
| Ferguson12exhib.pdf | 2012-04-12 11:50 | 1.7M | |
| Ferguson12exhib.xlsx | 2012-04-12 11:49 | 28K | |
| FrustatedIcos_DualSpaces.docx | 2010-10-10 22:05 | 151K | |
| Gallery-Cards.pdf | 2011-11-28 14:07 | 61K | |
| Gallery-Cards2.pdf | 2011-11-28 14:51 | 63K | |
| Gallery-Cards3.pdf | 2011-11-28 15:17 | 62K | |
| HF-show-2012/ | 2012-03-24 14:03 | - | |
| IMG_0208.JPG | 2010-11-18 22:46 | 170K | |
| INVITE.jpg | 2011-10-13 13:06 | 523K | |
| Interiors112508.pdf | 2008-12-03 18:19 | 6.4M | |
| LindeDinnerInvite.jpg | 2013-03-11 14:47 | 110K | |
| Lor.mw | 2010-08-24 22:12 | 1.0M | |
| M101.pdf | 2009-06-01 21:56 | 871K | |
| MathMuraljpeg11-29.jpg | 2011-11-29 13:47 | 1.8M | |
| Math Mural relief early stage.jpg | 2011-09-22 15:26 | 1.5M | |
| Math Mural without staircase.jpg | 2011-12-12 19:18 | 2.4M | |
| Math Mural with staircase.jpg | 2011-12-12 19:16 | 2.4M | |
| Mircheva.jpg | 2014-11-17 14:20 | 1.4M | |
| Museum_Memories_Didier_Maleuvre.pdf | 2015-02-26 23:51 | 301K | |
| NNWall2.pdf | 2010-06-09 22:51 | 13K | |
| NNWall2.tex | 2010-06-09 22:51 | 258 | |
| P1080379.jpg | 2013-03-07 13:26 | 305K | |
| P1080382.jpg | 2013-03-07 13:26 | 279K | |
| P1080385.jpg | 2013-03-07 13:26 | 300K | |
| P1080389.jpg | 2013-03-07 13:26 | 261K | |
| P1090420.jpg | 2013-10-23 12:45 | 373K | |
| PLATOS.pdf | 2010-03-17 16:43 | 21K | |
| PastedGraphic-1.pdf | 2013-11-09 14:38 | 317 | |
| Penrose-tiling.doc | 2015-07-24 16:20 | 32K | |
| PenroseModel1.pdf | 2010-03-05 17:46 | 24K | |
| SCGP-ART-CHECKLIST-JimJohnTony.pdf | 2013-10-07 10:29 | 32K | |
| SCGP-lobby-sm.jpg | 2008-09-02 23:22 | 338K | |
| SCGP.jpg | 2008-09-05 14:17 | 221K | |
| SIMONSbxy.jpg | 2011-11-27 15:29 | 3.4M | |
| SMathematic13052908020.pdf | 2013-05-29 08:28 | 512K | |
| SMathematic13052908021.pdf | 2013-05-29 08:28 | 348K | |
| SMathematic13053013380.pdf | 2013-05-30 14:01 | 171K | |
| SMathematic13053013381.pdf | 2013-05-30 14:01 | 136K | |
| SMathematic13053013390.pdf | 2013-05-30 14:01 | 245K | |
| Simons Center Plaza Lobby.jpg | 2008-09-02 23:20 | 3.3M | |
| SimonsFoundation-budget-8-17-13--ffd.docx | 2013-08-20 12:30 | 15K | |
| Simons_art.doc | 2010-03-05 16:12 | 35K | |
| UTDedication.docx | 2012-10-25 12:41 | 125K | |
| UmbilicalTorus.png | 2013-04-01 08:53 | 347K | |
| _region_.tex | 2010-03-09 19:16 | 16K | |
| a1115texfiles2.pdf | 2010-11-15 17:41 | 37K | |
| a120329formulas.log | 2012-03-30 20:03 | 1.5K | |
| a120329formulas.pdf | 2012-03-30 20:12 | 41K | |
| acirclesample.pdf | 2010-10-10 15:03 | 17K | |
| acircletext.pdf | 2010-08-24 23:32 | 27K | |
| aformulas.pdf | 2010-05-27 19:53 | 667K | |
| aformulas2.pdf | 2010-03-23 19:33 | 193K | |
| aformulas5.pdf | 2010-08-25 01:36 | 40K | |
| aharonov.eps | 2010-03-21 13:00 | 6.2K | |
| aj-suggestion.pdf | 2010-03-16 15:45 | 42K | |
| alexandria_library.jpg | 2010-03-05 18:34 | 133K | |
| apenrose-plaza.pdf | 2009-10-17 12:04 | 101K | |
| archimedes-logo.jpg | 2013-04-29 14:20 | 346K | |
| archimedes.eps | 2010-03-05 00:14 | 3.9K | |
| art-pos-desc.html | 2013-10-15 11:32 | 4.7K | |
| artmail | 2014-10-04 09:55 | 1.5K | |
| arts.html | 2013-05-07 21:19 | 208 | |
| axj-interview | 2008-03-05 17:06 | 2.3K | |
| batchellor-conf-of-birds.pdf | 2012-03-20 16:12 | 1.4M | |
| batchellor-matters-of-the-heart-save-the-date.pdf | 2012-03-20 16:13 | 541K | |
| bcartproposal1212.pdf | 2012-12-04 15:25 | 15M | |
| bcircletext.pdf | 2010-08-25 00:21 | 28K | |
| beasely-abj.pdf | 2010-03-07 23:11 | 15K | |
| beasely-dynkin.pdf | 2010-03-07 23:11 | 39K | |
| beasely-trefoil.R.pdf | 2010-03-07 23:11 | 24K | |
| behindStairC.pdf | 2010-03-16 15:41 | 150K | |
| benny.html | 2010-03-20 09:13 | 169 | |
| bformulas.pdf | 2010-05-27 19:56 | 667K | |
| bformulas2.pdf | 2010-03-18 14:05 | 227K | |
| blaine-Tony2.tex | 2010-03-07 15:29 | 474 | |
| blaine_Tony.pdf | 2010-03-07 11:52 | 16K | |
| blaine_Tony.tex | 2010-03-07 12:10 | 474 | |
| blurbs-1118-full.pdf | 2011-11-19 15:37 | 16M | |
| blurbs.doc | 2011-11-18 16:10 | 15M | |
| bold-test.pdf | 2010-09-15 10:10 | 85K | |
| bonnet-2.eps | 2010-03-09 19:14 | 4.3K | |
| bonnet.eps | 2010-03-05 03:14 | 5.0K | |
| braid.eps | 2010-03-05 16:53 | 4.1K | |
| cake.aux | 2012-04-19 14:19 | 8 | |
| cake.dvi | 2012-04-19 14:19 | 680 | |
| cake.log | 2012-04-19 14:19 | 2.7K | |
| cake.pdf | 2012-04-19 14:19 | 11K | |
| cake.pdf.pdf | 2012-04-19 14:18 | 2.1K | |
| cake.tex | 2012-04-19 14:19 | 226 | |
| capsules.aux | 2014-03-12 23:23 | 8 | |
| capsules.dvi | 2014-03-12 23:23 | 5.5K | |
| capsules.log | 2014-03-12 23:23 | 2.9K | |
| capsules.pdf | 2014-03-12 23:23 | 20K | |
| capsules.tex | 2014-03-12 23:23 | 4.4K | |
| catalogue/ | 2012-05-12 18:55 | - | |
| cauliflower.jpeg | 2014-07-22 14:26 | 958K | |
| cauliflower2.jpg | 2014-07-22 14:26 | 3.8M | |
| center.gif | 2008-03-05 16:55 | 40K | |
| center0811.jpg | 2008-11-05 21:50 | 411K | |
| cformulas2.pdf | 2010-03-18 14:06 | 228K | |
| circle-sg.aux | 2010-11-09 14:12 | 8 | |
| circle-sg.dvi | 2010-11-09 14:12 | 1.4K | |
| circle-sg.log | 2010-11-09 14:12 | 8.5K | |
| circle-sg.pdf | 2010-11-09 14:12 | 8.3K | |
| circle-sg.tex | 2010-11-09 14:12 | 402 | |
| circletext.aux | 2010-08-25 00:20 | 8 | |
| circletext.dvi | 2010-08-25 00:20 | 11K | |
| circletext.log | 2010-08-25 00:20 | 7.3K | |
| circletext.pdf | 2010-08-25 00:20 | 28K | |
| circletext.tex | 2010-08-25 00:19 | 2.1K | |
| circletext2.aux | 2010-08-25 00:37 | 8 | |
| circletext2.dvi | 2010-08-25 00:37 | 13K | |
| circletext2.log | 2010-08-25 00:37 | 7.3K | |
| circletext2.pdf | 2010-08-25 00:37 | 30K | |
| circletext2.tex | 2010-08-25 00:37 | 2.5K | |
| claude.pdf | 2010-03-05 14:24 | 83K | |
| claude.tex | 2010-03-05 15:10 | 7.8K | |
| claude2.aux | 2010-03-05 20:12 | 8 | |
| claude2.dvi | 2010-03-05 20:12 | 102K | |
| claude2.log | 2010-03-05 20:12 | 5.6K | |
| claude2.pdf | 2010-03-05 20:07 | 63K | |
| claude2.tex | 2010-03-05 20:21 | 7.0K | |
| committee/ | 2012-09-19 13:11 | - | |
| corrected-wall.jpg | 2010-11-18 22:45 | 388K | |
| cube.eps | 2010-03-08 12:23 | 46K | |
| cubic.eps | 2010-03-07 09:20 | 1.5M | |
| cwINVOICE2-29-12.pdf | 2012-03-01 12:33 | 23K | |
| dformulas2.pdf | 2010-03-18 14:08 | 228K | |
| dodecahedron.eps | 2010-03-08 12:24 | 46K | |
| douglasLetter2a.doc | 2011-10-12 15:09 | 21K | |
| duffy-sm.jpg | 2013-08-20 15:31 | 100K | |
| duffy.jpg | 2013-08-20 15:28 | 160K | |
| duffy/ | 2013-10-15 17:50 | - | |
| dynkin.eps | 2010-03-05 00:15 | 4.9K | |
| eformulas2.pdf | 2010-03-18 14:16 | 228K | |
| ferguson/ | 2014-06-06 16:13 | - | |
| feynman.eps | 2010-03-22 14:27 | 5.3K | |
| fformulas2.pdf | 2010-03-18 14:27 | 229K | |
| formulas.aux | 2012-03-31 16:21 | 8 | |
| formulas.dvi | 2012-03-31 16:21 | 3.0K | |
| formulas.log | 2012-03-31 16:21 | 8.3K | |
| formulas.pdf | 2010-08-24 22:15 | 668K | |
| formulas.pdf.pdf | 2010-03-07 09:36 | 2.1K | |
| formulas.tex | 2010-08-24 22:27 | 2.3K | |
| formulas0824.aux | 2015-05-03 13:18 | 8 | |
| formulas0824.log | 2015-05-03 13:18 | 10K | |
| formulas0824.pdf | 2015-05-03 13:18 | 139K | |
| formulas0824.tex | 2010-08-24 22:28 | 2.3K | |
| formulas3.aux | 2012-12-12 12:01 | 8 | |
| formulas3.dvi | 2012-12-12 12:01 | 7.8K | |
| formulas3.log | 2012-12-12 12:01 | 8.4K | |
| formulas3.pdf | 2012-12-12 12:01 | 63K | |
| formulas3.tex | 2010-05-13 01:16 | 5.5K | |
| formulas4.aux | 2010-05-21 16:20 | 8 | |
| formulas4.dvi | 2010-05-21 16:20 | 7.3K | |
| formulas4.log | 2010-05-21 16:20 | 8.4K | |
| formulas4.pdf | 2010-05-21 16:20 | 60K | |
| formulas4.tex | 2010-05-21 16:20 | 4.6K | |
| gala13-list | 2013-04-17 12:23 | 229 | |
| garden_show.pages | 2012-12-03 10:29 | 200K | |
| gformulas2.pdf | 2010-03-18 14:33 | 230K | |
| hack.aux | 2010-10-11 10:00 | 8 | |
| hack.dvi | 2010-10-11 10:00 | 1.3K | |
| hack.log | 2010-10-11 10:00 | 6.2K | |
| hack.pdf | 2010-10-11 10:01 | 6.8K | |
| hack.tex | 2010-10-11 10:00 | 452 | |
| hack2.aux | 2010-10-11 11:55 | 8 | |
| hack2.dvi | 2010-10-11 11:55 | 1.4K | |
| hack2.log | 2010-10-11 11:55 | 6.2K | |
| hack2.pdf | 2010-10-11 11:55 | 8.3K | |
| hack2.tex | 2010-10-11 11:55 | 556 | |
| hf-070912.jpg | 2012-07-11 16:10 | 40K | |
| hformulas2.pdf | 2010-03-18 14:35 | 229K | |
| iconic wall-middle.pdf | 2010-11-18 16:08 | 8.1M | |
| icosahedron.eps | 2010-03-08 12:24 | 46K | |
| images.aux | 2010-03-22 14:32 | 8 | |
| images.dvi | 2010-03-21 13:05 | 2.8K | |
| images.log | 2010-03-22 14:32 | 9.3K | |
| images.pdf | 2010-03-21 13:05 | 172K | |
| images.tex | 2010-03-22 14:32 | 2.4K | |
| images2.aux | 2010-03-22 14:34 | 8 | |
| images2.dvi | 2010-03-22 14:34 | 516 | |
| images2.log | 2010-03-22 14:34 | 7.8K | |
| images2.pdf | 2010-03-22 14:34 | 14K | |
| images2.tex | 2010-03-22 14:33 | 1.0K | |
| jay-dec1.pdf | 2012-12-01 15:13 | 15M | |
| jay1112.pdf | 2012-12-10 15:23 | 15M | |
| laminar-1.eps | 2010-10-06 22:45 | 68K | |
| laminar-1.pdf | 2010-10-06 22:48 | 30K | |
| laminar.eps | 2010-10-05 10:37 | 12K | |
| laza_cubic.jpg | 2010-03-05 18:14 | 40K | |
| light.eps | 2010-03-05 12:53 | 43K | |
| lobby-plus7.fla | 2010-05-12 02:14 | 634K | |
| logo4cxx.gif | 2008-09-05 17:31 | 3.0K | |
| lor.eps | 2010-08-24 22:12 | 398K | |
| mandelbrot-fake-sm.eps | 2010-03-07 22:57 | 265K | |
| mandelbrot.eps | 2010-03-21 12:16 | 16K | |
| milnor-eratos.ps | 2010-03-08 17:06 | 873 | |
| milnor-kep.log | 2010-03-09 12:10 | 1.3K | |
| milnor-kep.tex | 2010-03-09 12:09 | 201 | |
| milnor-keppic.ps | 2010-03-09 16:48 | 1.9K | |
| milnor-keppic2.ps | 2010-03-10 10:51 | 1.9K | |
| milnor-keptest.ps | 2010-03-09 12:09 | 1.5K | |
| milnor-tony.eqs.pdf | 2010-03-09 16:39 | 31K | |
| miriam-photo.JPG | 2011-11-13 20:11 | 2.1M | |
| miriam-photo2.JPG | 2011-11-13 20:13 | 1.8M | |
| miriam-photo3.JPG | 2011-11-13 20:17 | 2.0M | |
| nekrasov_0.gif | 2010-03-07 11:52 | 24K | |
| new-flatcircletext.ps | 2013-01-09 22:34 | 272K | |
| new-large-equations.ps | 2013-01-09 22:34 | 270K | |
| newsletter0715.docx | 2015-07-14 16:17 | 13M | |
| newsletter0719.docx | 2015-07-19 16:28 | 4.3M | |
| nguyen | 2013-03-20 14:42 | 5.8K | |
| nikita_SCGP.jpg | 2010-03-06 00:15 | 134K | |
| nobi-Lobby-View_metatrons3.jpg | 2010-03-13 09:56 | 20K | |
| nobi-Metatron_CObalt_DOTS.rev.pdf | 2010-03-13 09:57 | 46K | |
| nobi-Metatron_rev.pdf | 2010-03-13 09:57 | 46K | |
| nobi-metatrons_cube.gif | 2010-03-13 09:57 | 7.4K | |
| nobi1.html | 2010-03-13 09:56 | 1.5K | |
| octahedron.eps | 2010-03-08 12:24 | 46K | |
| old-poster.html | 2008-11-05 21:52 | 2.5K | |
| oldcircletext.tex | 2010-07-03 13:39 | 1.6K | |
| openingexhibitionblurbs-1118.doc | 2011-11-18 15:28 | 15M | |
| palmedo.html | 2014-02-12 13:08 | 346 | |
| pam-davis/ | 2013-11-13 11:08 | - | |
| pascal.eps | 2010-03-05 00:15 | 6.7K | |
| pedro-PLATOS.pdf | 2010-03-17 16:54 | 21K | |
| penrose-demo.eps | 2009-10-17 00:42 | 16K | |
| penrose-plaza-vert.eps | 2009-10-17 00:44 | 5.0M | |
| penrose-plaza.aux | 2009-10-19 04:31 | 8 | |
| penrose-plaza.dvi | 2009-10-19 04:31 | 3.0K | |
| penrose-plaza.eps | 2009-10-17 00:42 | 5.0M | |
| penrose-plaza.log | 2009-10-19 04:31 | 3.6K | |
| penrose-plaza.pdf | 2009-10-19 04:31 | 101K | |
| penrose-plaza.tex | 2009-10-19 04:31 | 2.3K | |
| penrose-text | 2015-06-23 10:51 | 658 | |
| penrose-tiling.doc | 2015-07-24 16:19 | 870 | |
| penrose-tiling/ | 2015-03-19 15:19 | - | |
| penrose10.21.15.pdf | 2015-10-21 13:21 | 1.7M | |
| penta.eps | 2010-03-06 00:15 | 2.7M | |
| pentagon.eps | 2010-03-07 12:58 | 4.4K | |
| peter-van-eq.pdf | 2010-03-08 19:55 | 40K | |
| peter-van-eq.tex | 2010-03-08 19:59 | 237 | |
| poster-test.pdf | 2008-12-03 17:59 | 233K | |
| poster.html | 2008-11-05 21:52 | 2.5K | |
| pythagoras.eps | 2010-03-05 00:15 | 3.3K | |
| scgp-1.jpg | 2008-09-05 14:40 | 120K | |
| scgp-2.jpg | 2008-09-05 17:14 | 212K | |
| scgp-pos-desc.aux | 2013-10-15 15:04 | 8 | |
| scgp-pos-desc.dvi | 2013-10-15 15:04 | 4.8K | |
| scgp-pos-desc.log | 2013-10-15 15:04 | 3.3K | |
| scgp-pos-desc.pdf | 2013-10-15 15:04 | 18K | |
| scgp-pos-desc.tex | 2013-10-15 15:04 | 3.5K | |
| scott-lorenz.eps | 2010-03-07 22:26 | 393K | |
| scott3D.pdf | 2010-10-11 23:47 | 18K | |
| scott3D.ps | 2010-10-11 23:42 | 313K | |
| scott_apollonian.eps | 2010-03-06 17:37 | 1.1K | |
| scott_sierpinski.eps | 2010-03-06 17:37 | 1.1M | |
| simons.pdf | 2010-03-05 17:03 | 80K | |
| snell.eps | 2010-03-05 16:53 | 12K | |
| spiral.eps | 2010-03-05 17:57 | 4.3K | |
| spreadsheet | 2014-03-05 13:18 | 8.9K | |
| starr-elliptic1.jpg | 2010-03-06 10:21 | 18K | |
| sterman_DE0004H.jpg | 2010-03-05 19:27 | 137K | |
| sterman_geom.gif | 2010-03-05 18:08 | 7.0K | |
| sterman_test.pdf | 2010-03-05 19:23 | 19K | |
| sukie-ad.doc | 2015-07-11 22:22 | 52K | |
| supergravity.tex | 2010-11-09 14:06 | 796 | |
| t.10.eps | 2010-03-05 13:03 | 3.7K | |
| t.11.eps | 2010-03-05 19:49 | 3.7K | |
| t.12.eps | 2010-03-05 19:47 | 3.7K | |
| tetrahedron.eps | 2010-03-08 12:21 | 46K | |
| texfiles2.pdf | 2010-10-13 21:47 | 2.1K | |
| tiling/ | 2015-07-29 10:48 | - | |
| to_nina110809 | 2011-08-09 12:17 | 1.7K | |
| tony.eqs.pdf | 2010-03-16 15:43 | 31K | |
| trefoil.eps | 2010-03-08 19:44 | 1.1K | |
| triangle.eps | 2010-03-06 19:45 | 7.2K | |
| wall-detail-sm.jpg | 2011-06-10 12:21 | 192K | |
| wall-images/ | 2010-04-22 16:12 | - | |
| wall-sm.jpg | 2011-06-10 12:21 | 187K | |
| wall-story/ | 2015-08-11 20:57 | - | |
| wall3.gif | 2010-04-13 23:31 | 57K | |
| wall7.jpg | 2010-05-12 02:14 | 34K | |
| wild-sphere.jpg | 2011-07-07 10:56 | 40K | |
| x.log | 2010-08-25 01:56 | 1.4K | |